Informação sobre produto
Nome:5-(Hydroxymethyl)quinolin-8-ol
Sinónimos:
- 5-quinolinemethanol
- 8-hydroxy-
Marca:Biosynth
Descrição:5-(Hydroxymethyl)quinolin-8-ol is a molecule that inhibits the activity of some molecules. It has been shown to have neuroprotective properties and can be used to treat brain injury. 5-(Hydroxymethyl)quinolin-8-ol also has antimicrobial properties, and it can be used to control growth of bacterial strains such as Pseudomonas aeruginosa and Escherichia coli. This compound binds to metal surface and inhibits the growth of bacteria by inhibiting the synthesis of cellular components, such as proteins and nucleic acids.
5-(Hydroxymethyl)quinolin-8-ol is an inhibitor that can be used for treatment of brain injury or for controlling bacterial growth. It binds to metal surfaces and prevents the production of proteins and nucleic acids in cells, which leads to cell death.
5-(Hydroxymethyl)quinolin-8-ol is an inhibitor that can be used for treatment of brain injury or for controlling bacterial growth. It binds to metal surfaces and prevents the production of proteins and nucleic acids in cells, which leads to cell death.
Aviso:Os nossos productos estão destinados exclusivamente para uso em laboratório. Para qualquer outra aplicação, por favor entre em contacto.
Propriedades químicas
Peso molecular:175.18 g/mol
Fórmula:C10H9NO2
Pureza:Min. 95%
InChI:InChI=1S/C10H9NO2/c12-6-7-3-4-9(13)10-8(7)2-1-5-11-10/h1-5,12-13H,6H2
Chave InChI:InChIKey=ZBNACESDSSHENJ-UHFFFAOYSA-N
SMILES:OCc1ccc(O)c2ncccc12