Informação sobre produto
Nome:Hypocrellin C
Marca:Biosynth
Descrição:Hypocrellin C is a naturally occurring perylenequinone derivative, which is a pigment isolated from the fungi Hypocrella bambusae and other related species. This compound is characterized by its distinctive photodynamic activity, which involves the generation of reactive oxygen species (ROS) upon exposure to specific wavelengths of light. The photodynamic action of Hypocrellin C is facilitated by its ability to absorb light and subsequently transfer energy to molecular oxygen, producing singlet oxygen and other reactive intermediates.
Aviso:Os nossos productos estão destinados exclusivamente para uso em laboratório. Para qualquer outra aplicação, por favor entre em contacto.
Propriedades químicas
Peso molecular:528.51 g/mol
Fórmula:C30H24O9
Pureza:Min. 95%
Cor/forma:Red Powder
InChI:InChI=1S/C30H24O9/c1-10-7-12-18-23-19(27(34)29(12)38-5)13(32)8-15(36-3)21(23)22-16(37-4)9-14(33)20-25(22)24(18)26(17(10)11(2)31)30(39-6)28(20)35/h8-9,34-35H,7H2,1-6H3
Chave InChI:InChIKey=SBMXTMAIKRQSQE-UHFFFAOYSA-N
SMILES:COc1c(O)c2c(=O)cc(OC)c3c4c(OC)cc(=O)c5c(O)c(OC)c6c(c(c1CC(C)=C6C(C)=O)c23)c54
Consulta técnica sobre Hypocrellin C
Por favor, utilize o carrinho para solicitar um orçamento ou uma encomenda
Por favor, utilize o carrinho para solicitar um orçamento ou uma encomenda. Se desejar solicitar um orçamento ou fazer uma encomenda, por favor, adicione os produtos ao seu carrinho e depois solicite um orçamento ou encomenda a partir do carrinho. É mais rápido, mais barato e poderá beneficiar-se dos descontos e outras vantagens disponíveis.