Informação sobre produto
Nome:9-Hydroxyfluorene
Produto Controlado
Marca:Biosynth
Descrição:9-Hydroxyfluorene is a chiral compound that exhibits antimicrobial activity. It has been shown to inhibit the growth of bacteria by interacting with bacterial DNA and preventing RNA synthesis. 9-Hydroxyfluorene binds to bacterial DNA, specifically the nitrogen atoms, which are not present in mammalian DNA. This binding causes the formation of intramolecular hydrogen bonds that inhibits bacterial DNA replication. 9-Hydroxyfluorene also interacts with cellular membranes, inhibiting protein synthesis and cell division. The antimicrobial properties of 9-hydroxyfluorene are due to its ability to bind to bacterial membranes and form hydrogen bonds at specific sites on the membrane surface. This binding alters the membrane's physical properties, leading to cell death.
Aviso:Os nossos productos estão destinados exclusivamente para uso em laboratório. Para qualquer outra aplicação, por favor entre em contacto.
Propriedades químicas
Peso molecular:182.22 g/mol
Fórmula:C13H10O
Pureza:Min. 95%
InChI:InChI=1S/C13H10O/c14-13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)13/h1-8,13-14H
Chave InChI:InChIKey=AFMVESZOYKHDBJ-UHFFFAOYSA-N
SMILES:OC1c2ccccc2-c2ccccc21
Consulta técnica sobre 9-Hydroxyfluorene
Por favor, utilize o carrinho para solicitar um orçamento ou uma encomenda
Por favor, utilize o carrinho para solicitar um orçamento ou uma encomenda. Se desejar solicitar um orçamento ou fazer uma encomenda, por favor, adicione os produtos ao seu carrinho e depois solicite um orçamento ou encomenda a partir do carrinho. É mais rápido, mais barato e poderá beneficiar-se dos descontos e outras vantagens disponíveis.
