Informação sobre produto
Nome:3-Hydroxyflavone
Sinónimos:
- Flavon-3-ol 3-Hydroxy-2-phenylchromone
Marca:Biosynth
Descrição:3-Hydroxyflavone is a naturally derived flavonoid compound found in various plants. As a member of the flavonoid family, it is synthesized through the phenylpropanoid pathway, starting from phenylalanine or tyrosine in plants. Its unique structure allows it to interact with a range of biological targets through its antioxidant, anti-inflammatory, and enzyme modulation properties. The mode of action primarily involves the scavenging of free radicals and reactive oxygen species, as well as the inhibition of specific enzymes such as cyclooxygenases and lipoxygenases. These actions contribute to its protective effects against oxidative stress and inflammation.
Aviso:Os nossos productos estão destinados exclusivamente para uso em laboratório. Para qualquer outra aplicação, por favor entre em contacto.
Propriedades químicas
Peso molecular:238.24 g/mol
Fórmula:C15H10O3
Pureza:Min. 95%
Cor/forma:Powder
InChI:InChI=1S/C15H10O3/c16-13-11-8-4-5-9-12(11)18-15(14(13)17)10-6-2-1-3-7-10/h1-9,17H
Chave InChI:InChIKey=HVQAJTFOCKOKIN-UHFFFAOYSA-N
SMILES:O=c1c(O)c(-c2ccccc2)oc2ccccc12
Consulta técnica sobre 3-Hydroxyflavone
Por favor, utilize o carrinho para solicitar um orçamento ou uma encomenda
Se desejar solicitar um orçamento ou efetuar uma encomenda, adicione, por favor, os produtos pretendidos ao carrinho e faça a gestão do pedido a partir daí. É mais rápido, mais económico e poderá beneficiar dos descontos e das vantagens disponíveis.