Informação sobre produto
Nome:3-Hydroxyphenyl benzoate
Sinónimos:
- Benzoic Acid 3-Hydroxyphenyl EsterResorcinol Monobenzoate
Marca:Biosynth
Descrição:3-Hydroxyphenyl benzoate is a low potency ester of estradiol benzoate. The chemical stability of the compound is due to its reaction with zirconium oxide, which converts the benzoate to 3-hydroxyphenyl benzoate. Other possible reactions involve radiation and calcium stearate. 3-Hydroxyphenyl benzoate has been used as a photoresist in the production of polyvinyl chloride (PVC). When exposed to ultraviolet light, it undergoes photolysis and absorbs light at wavelengths between 240 nm and 280 nm. This absorption leads to an increase in temperature that causes polymerization and crosslinking of the PVC, leading to an increased hardness and durability.
Aviso:Os nossos productos estão destinados exclusivamente para uso em laboratório. Para qualquer outra aplicação, por favor entre em contacto.
Propriedades químicas
Peso molecular:214.22 g/mol
Fórmula:C13H10O3
Pureza:Min. 95%
InChI:InChI=1S/C13H10O3/c14-11-7-4-8-12(9-11)16-13(15)10-5-2-1-3-6-10/h1-9,14H
Chave InChI:InChIKey=GDESWOTWNNGOMW-UHFFFAOYSA-N
SMILES:O=C(Oc1cccc(O)c1)c1ccccc1
Consulta técnica sobre 3-Hydroxyphenyl benzoate
Por favor, utilize o carrinho para solicitar um orçamento ou uma encomenda
Por favor, utilize o carrinho para solicitar um orçamento ou uma encomenda. Se desejar solicitar um orçamento ou fazer uma encomenda, por favor, adicione os produtos ao seu carrinho e depois solicite um orçamento ou encomenda a partir do carrinho. É mais rápido, mais barato e poderá beneficiar-se dos descontos e outras vantagens disponíveis.