

Informação sobre produto
Nome:2-Isopropoxybenzoic acid
Marca:Biosynth
Descrição:2-Isopropoxybenzoic acid is an organic compound that is used as a reducing agent. It is an acid that has the ability to remove hydroxide ions from a solution. 2-Isopropoxybenzoic acid can be used in the preparation of carbanions, which are highly reactive chemical species containing C-O bonds. These compounds are useful for bond cleavage reactions, such as hydrolysis and oxidation. 2-Isopropoxybenzoic acid also reduces tyrosine kinase activity by acting as a competitive inhibitor, but does not inhibit other tyrosine protein kinases. This drug may also act as an aluminium chelator and reduce phosphonium salts to produce photoelectrons. The resulting electron transfer can react with salicylic acid and methyl alcohol to generate functional groups, such as esters or amides.
Aviso:Os nossos productos estão destinados exclusivamente para uso em laboratório. Para qualquer outra aplicação, por favor entre em contacto.
Propriedades químicas
Peso molecular:180.2 g/mol
Fórmula:C10H12O3
Pureza:Min. 95%
InChI:InChI=1S/C10H12O3/c1-7(2)13-9-6-4-3-5-8(9)10(11)12/h3-7H,1-2H3,(H,11,12)
Chave InChI:InChIKey=WWPLDSOFBMZGIJ-UHFFFAOYSA-N
SMILES:CC(C)Oc1ccccc1C(=O)O