Informação sobre produto
Nome:4-Isopropylphenol
Marca:Biosynth
Descrição:4-Isopropylphenol is a phenolic compound that can be found in food, cosmetics and pharmaceuticals. It is known for its ability to bind to the hydroxyl group of other molecules, which may result in hydrogen bonding interactions. 4-Isopropylphenol has been shown to have antifungal activity against Candida albicans and Saccharomyces cerevisiae. This may be due to its ability to react with the surface of these organisms and inhibit their growth by interfering with cellular respiration pathways. The reaction solution for 4-isopropylphenol contains activated carbon (C), hydrochloric acid (HCl), and proton (H). The kinetic rate equation for this reaction is:
4-Isopropylphenol + C --> C + 4-Isopropylphenol
where C represents activated carbon and H represents hydrochloric acid.
4-Isopropylphenol + C --> C + 4-Isopropylphenol
where C represents activated carbon and H represents hydrochloric acid.
Aviso:Os nossos productos estão destinados exclusivamente para uso em laboratório. Para qualquer outra aplicação, por favor entre em contacto.
Propriedades químicas
Peso molecular:136.19 g/mol
Fórmula:C9H12O
Pureza:Min. 97.5%
InChI:InChI=1S/C9H12O/c1-7(2)8-3-5-9(10)6-4-8/h3-7,10H,1-2H3
Chave InChI:InChIKey=YQUQWHNMBPIWGK-UHFFFAOYSA-N
SMILES:CC(C)c1ccc(O)cc1