

Informação sobre produto
Nome:2-Methylthiobenzoxazole
Marca:Biosynth
Descrição:2-Methylthiobenzoxazole is a molecule that has been studied for its potential use as a pesticide. It binds to the thiol group of cysteine residues in proteins and causes defoliation by inhibiting protein synthesis. The 2-methylthiobenzoxazole is also able to bind to other amino acid residues, such as cysteine, methionine, and histidine. This molecule has a high potency and can be used in solid form. The 2-methylthiobenzoxazole is not toxic to mammals because it quickly converts into an inactive form when exposed to air or light. This compound may have potential as a linker between two molecules with different properties, such as drug molecules and protein-binding molecules.
Aviso:Os nossos productos estão destinados exclusivamente para uso em laboratório. Para qualquer outra aplicação, por favor entre em contacto.
Propriedades químicas
Peso molecular:165.21 g/mol
Fórmula:C8H7NOS
Pureza:Min. 95%
InChI:InChI=1S/C8H7NOS/c1-11-8-9-6-4-2-3-5-7(6)10-8/h2-5H,1H3
Chave InChI:InChIKey=CBXAWZGFEDZKFR-UHFFFAOYSA-N
SMILES:CSc1nc2ccccc2o1