Informação sobre produto
Nome:Methyl 3-hydroxybenzoate
Sinónimos:
- 3-Hydroxy-benzoic acid methyl ester
Marca:Biosynth
Descrição:Methyl 3-hydroxybenzoate is a fumigant that emits light when reacted with a base, such as potassium hydroxide. It is used in biological studies to identify DNA and RNA sequences. Methyl 3-hydroxybenzoate reacts with 5-nitrosalicylic acid to form an intermediate, which reacts with the hydroxyl group of a methyl ester or carboxylic acid to form an amine. This reaction can be catalyzed by phosphatases, which are enzymes that break down phosphate groups from molecules. The methyl ester group on methyl 3-hydroxybenzoate has been shown to react with intramolecular hydrogen bonds, leading to the formation of a molecule with two hydroxy groups.
Aviso:Os nossos productos estão destinados exclusivamente para uso em laboratório. Para qualquer outra aplicação, por favor entre em contacto.
Propriedades químicas
Peso molecular:152.15 g/mol
Fórmula:C8H8O3
Pureza:Min. 98 Area-%
Cor/forma:Powder
InChI:InChI=1S/C8H8O3/c1-11-8(10)6-3-2-4-7(9)5-6/h2-5,9H,1H3
Chave InChI:InChIKey=YKUCHDXIBAQWSF-UHFFFAOYSA-N
SMILES:COC(=O)c1cccc(O)c1
Consulta técnica sobre Methyl 3-hydroxybenzoate
Por favor, utilize o carrinho para solicitar um orçamento ou uma encomenda
Por favor, utilize o carrinho para solicitar um orçamento ou uma encomenda. Se desejar solicitar um orçamento ou fazer uma encomenda, por favor, adicione os produtos ao seu carrinho e depois solicite um orçamento ou encomenda a partir do carrinho. É mais rápido, mais barato e poderá beneficiar-se dos descontos e outras vantagens disponíveis.
