Informação sobre produto
Nome:N-Methyl-N-vinylacetamide
Sinónimos:
- N-Ethenyl-N-methyl-acetamide
Marca:Biosynth
Descrição:N-Methyl-N-vinylacetamide is a colorless liquid with a boiling point of 105.6°C. It is produced by the reaction of acetamide and vinyl chloride in the presence of hydrochloric acid, glycol ether, and methyl ethyl ketone. The viscosity of this compound is low, which makes it an ideal solvent for paints and coatings. N-Methyl-N-vinylacetamide also has genetic damaging effects and can cause mutations in bacteria that are exposed to this compound in high concentrations. This product has an unusual chemical structure due to its hydrogen bonding interactions.br>br>
br>br>
Hydrogen bonds are weak intermolecular forces between polar molecules, such as water or alcohols, that are formed by the attraction between a partially positive hydrogen atom on one molecule and the negative end of another nearby molecule. Hydrogen bonds stabilize certain molecular structures because they provide partial shielding from electrostatic interactions with
br>br>
Hydrogen bonds are weak intermolecular forces between polar molecules, such as water or alcohols, that are formed by the attraction between a partially positive hydrogen atom on one molecule and the negative end of another nearby molecule. Hydrogen bonds stabilize certain molecular structures because they provide partial shielding from electrostatic interactions with
Aviso:Os nossos productos estão destinados exclusivamente para uso em laboratório. Para qualquer outra aplicação, por favor entre em contacto.
Propriedades químicas
Peso molecular:99.13 g/mol
Fórmula:C5H9NO
Pureza:Min. 97.5%
Cor/forma:Clear Liquid
InChI:InChI=1S/C5H9NO/c1-4-6(3)5(2)7/h4H,1H2,2-3H3
Chave InChI:InChIKey=PNLUGRYDUHRLOF-UHFFFAOYSA-N
SMILES:C=CN(C)C(C)=O
Consulta técnica sobre N-Methyl-N-vinylacetamide
Por favor, utilize o carrinho para solicitar um orçamento ou uma encomenda
Por favor, utilize o carrinho para solicitar um orçamento ou uma encomenda. Se desejar solicitar um orçamento ou fazer uma encomenda, por favor, adicione os produtos ao seu carrinho e depois solicite um orçamento ou encomenda a partir do carrinho. É mais rápido, mais barato e poderá beneficiar-se dos descontos e outras vantagens disponíveis.