

Informação sobre produto
Nome:Methyl-2-bromo-2-phenylacetate
Marca:Biosynth
Descrição:Methyl-2-bromo-2-phenylacetate is a synthetic molecule with a molecular formula of CHBrO. It is used to synthesize bioactive molecules such as nitrosoarenes and amides, which have anticancer properties. Methyl-2-bromo-2-phenylacetate has been shown to be effective against the growth of cancer cells in mice by inhibiting the production of proteins that are involved in cell division or the development of Alzheimer's disease. The compound also has antiinflammatory effects, which may be due to its inhibition of prostaglandin synthesis.
Methyl-2-bromo-2-phenylacetate is soluble in water and most organic solvents, but not in hydrocarbons. It has a melting point of around 59 degrees Celsius and can be stored for up to one year at room temperature without significant degradation.
Methyl-2-bromo-2-phenylacetate is soluble in water and most organic solvents, but not in hydrocarbons. It has a melting point of around 59 degrees Celsius and can be stored for up to one year at room temperature without significant degradation.
Aviso:Os nossos productos estão destinados exclusivamente para uso em laboratório. Para qualquer outra aplicação, por favor entre em contacto.
Propriedades químicas
Peso molecular:229.07 g/mol
Fórmula:C9H9BrO2
Pureza:Min. 95%
InChI:InChI=1S/C9H9BrO2/c1-12-9(11)8(10)7-5-3-2-4-6-7/h2-6,8H,1H3
Chave InChI:InChIKey=NHFBYYMNJUMVOT-UHFFFAOYSA-N
SMILES:COC(=O)C(Br)c1ccccc1