

Informação sobre produto
Nome:2-Pentafluorophenoxyethanol
Marca:Biosynth
Descrição:2-Pentafluorophenoxyethanol is a reactive chemical that is used in the production of pharmaceuticals and other organic chemicals. It can be used to produce 2-methylpentane, which is used as an intermediate product in the synthesis of several drugs, including fluoxetine and piperidine. 2-Pentafluorophenoxyethanol reacts with chloride ions to form ethane, pentafluorophenyl esters, and polyols. This chemical also reacts with nitrite ions to form amino acids. 2-Pentafluorophenoxyethanol can react with anions such as sulfate or phosphate to form anionic products. It can also react with carbohydrate molecules containing aldehyde or ketone groups to form vinyl ethers. Reactive chemicals like 2-pentafluorophenoxyethanol are not only used for industrial purposes but also have applications in the field of biochemistry.
Aviso:Os nossos productos estão destinados exclusivamente para uso em laboratório. Para qualquer outra aplicação, por favor entre em contacto.
Propriedades químicas
Peso molecular:228.12 g/mol
Fórmula:C8H5F5O2
Pureza:Min. 95%
InChI:InChI=1S/C8H5F5O2/c9-3-4(10)6(12)8(15-2-1-14)7(13)5(3)11/h14H,1-2H2
Chave InChI:InChIKey=NPVVUYMVRISVGK-UHFFFAOYSA-N
SMILES:OCCOc1c(F)c(F)c(F)c(F)c1F