
Phenyl trifluoromethylsulfone
CAS:
Ref. 3D-FP11234

Informação sobre produto
Nome:Phenyl trifluoromethylsulfone
Marca:Biosynth
Descrição:Phenyl trifluoromethylsulfone is a sulfone with a hydroxy group. It is an extractant, used for the extraction of radionuclides such as strontium-90 and cesium-137. Phenyl trifluoromethylsulfone can be used to treat skin cancer, due to its ability to inhibit the growth of cells in the epidermis. The reaction starts with the formation of a phenol intermediate that reacts with a nucleophilic reagent (such as water) to form an acidic product and a phosphoric acid ester. The exothermic reaction causes heat production, which can lead to spontaneous combustion if there is insufficient ventilation. Phenyl trifluoromethylsulfone has been shown to be resistant to carbonyl compounds such as benzaldehyde, acetaldehyde and cyclohexanone.
Aviso:Os nossos productos estão destinados exclusivamente para uso em laboratório. Para qualquer outra aplicação, por favor entre em contacto.
Propriedades químicas
Peso molecular:210.17 g/mol
Fórmula:C7H5F3O2S
Pureza:Min. 95%
Cor/forma:Colorless Clear Liquid
InChI:InChI=1S/C7H5F3O2S/c8-7(9,10)13(11,12)6-4-2-1-3-5-6/h1-5H
Chave InChI:InChIKey=UPGBQYFXKAKWQC-UHFFFAOYSA-N
SMILES:O=S(=O)(c1ccccc1)C(F)(F)F