
Pyridine-3-sulfonic acid
CAS:
Ref. 3D-FP11287

Informação sobre produto
Nome:Pyridine-3-sulfonic acid
Marca:Biosynth
Descrição:Pyridine-3-sulfonic acid is a reactive molecule that can exist in two forms. It reacts with iron oxides to form pyridine-3-sulfonic acid amide and reacts with picolinic acid to form pyridine-3-sulfonic acid phosphoric acid complex. Pyridine 3 sulfonic acid is an intermediate in the synthesis of picolinic acid and is involved in the genetic mechanisms of bacteria. It has been shown to be effective at concentrations of 10 mM or higher when used in tissue culture experiments. The optimum concentration for the reaction varies depending on the reactant and its environment, which is why experimentation should be conducted before using it as a reagent.
Aviso:Os nossos productos estão destinados exclusivamente para uso em laboratório. Para qualquer outra aplicação, por favor entre em contacto.
Propriedades químicas
Peso molecular:159.16 g/mol
Fórmula:C5H5NO3S
Pureza:Min. 95%
InChI:InChI=1S/C5H5NO3S/c7-10(8,9)5-2-1-3-6-4-5/h1-4H,(H,7,8,9)
Chave InChI:InChIKey=DVECLMOWYVDJRM-UHFFFAOYSA-N
SMILES:O=S(=O)(O)c1cccnc1