

Informação sobre produto
Nome:1-Propylbutylamine
Sinónimos:
- 4-Aminoheptane
Marca:Biosynth
Descrição:1-Propylbutylamine is an organic compound that is used as a reagent in the synthesis of other compounds. It can be used in analytical toxicology to determine the presence of drugs. 1-Propylbutylamine is an isomer of n-butyl amine, but has a different molecular structure. The intramolecular hydrogen bonds are formed between the nitrogen atoms and the carbonyl group on the adjacent carbon atom. The photophysical properties and chemical reactivity of 1-propylbutylamine depend on its structural features. It reacts with chloride ions to form hydrochloric acid, and undergoes amination reactions with methyl ketones to form substituted amines. This compound may also be used in the manufacture of recycled plastics because it contains chlorine, which can be removed by burning off excess hydrogen chloride gas. 1-Propylbutylamine also has pressor effects due to its ability to release nitric oxide from endothelial cells,
Aviso:Os nossos productos estão destinados exclusivamente para uso em laboratório. Para qualquer outra aplicação, por favor entre em contacto.
Propriedades químicas
Peso molecular:115.22 g/mol
Fórmula:C7H17N
Pureza:Min. 95%
InChI:InChI=1S/C7H17N/c1-3-5-7(8)6-4-2/h7H,3-6,8H2,1-2H3
Chave InChI:InChIKey=CLJMMQGDJNYDER-UHFFFAOYSA-N
SMILES:CCCC(N)CCC