Informação sobre produto
Nome:Protohypericin
Sinónimos:
- 1,3,4,6,8,15-Hexahydroxy-10,13-dimethyldibenzo[a,o]perylene-7,16-dione
Marca:Biosynth
Descrição:Protohypericin is a photosensitizer, which is a compound known for its ability to absorb light and induce a photodynamic response. This compound is derived from the plant Hypericum perforatum, commonly known as St. John's Wort. The primary mode of action of protohypericin involves the absorption of specific wavelengths of light, leading to the generation of reactive oxygen species (ROS). These ROS are capable of inducing cell death, primarily through mechanisms such as apoptosis and necrosis.
Aviso:Os nossos productos estão destinados exclusivamente para uso em laboratório. Para qualquer outra aplicação, por favor entre em contacto.
Propriedades químicas
Peso molecular:506.46 g/mol
Fórmula:C30H18O8
Pureza:Min. 95%
Cor/forma:Powder
InChI:InChI=1S/C30H18O8/c1-9-3-11-19(13(31)5-9)29(37)25-17(35)7-15(33)23-24-16(34)8-18(36)26-28(24)22(21(11)27(23)25)12-4-10(2)6-14(32)20(12)30(26)38/h3-8,33-38H,1-2H3
Chave InChI:InChIKey=DPKVSJZTYNGFAW-UHFFFAOYSA-N
SMILES:Cc1cc(=O)c2c(O)c3c(O)cc(O)c4c5c(O)cc(O)c6c(O)c7c(=O)cc(C)cc7c(c65)c(c2c1)c34
Consulta técnica sobre Protohypericin
Por favor, utilize o carrinho para solicitar um orçamento ou uma encomenda
Por favor, utilize o carrinho para solicitar um orçamento ou uma encomenda. Se desejar solicitar um orçamento ou fazer uma encomenda, por favor, adicione os produtos ao seu carrinho e depois solicite um orçamento ou encomenda a partir do carrinho. É mais rápido, mais barato e poderá beneficiar-se dos descontos e outras vantagens disponíveis.
