Informação sobre produto
Nome:Pyraclostrobin
Sinónimos:
- N-[2-[[[1-(4-Chlorophenyl)-1H-pyrazol-3-yl]oxy]methyl]phenyl]-N-methoxycarbamic acid methyl ester[2-[[[1-(4-Chlorophenyl)-1H-pyrazo l-3-yl]oxy]methyl]phenyl]methoxycarbamic acid methyl esterBAS 500F
Marca:Biosynth
Descrição:Pyraclostrobin is a fungicide, which is a synthetic compound derived from the strobilurin class of fungicidal chemistry. It is characterized as a product of chemical synthesis designed to inhibit fungal growth through its unique mode of action. Pyraclostrobin functions by disrupting mitochondrial respiration in the targeted fungi, specifically inhibiting electron transfer at the cytochrome bc1 complex. This interference halts ATP production, ultimately leading to the death of the fungal cells.
Aviso:Os nossos productos estão destinados exclusivamente para uso em laboratório. Para qualquer outra aplicação, por favor entre em contacto.
Propriedades químicas
Peso molecular:387.82 g/mol
Fórmula:C19H18ClN3O4
Pureza:Min. 95%
Cor/forma:Powder
InChI:InChI=1S/C19H18ClN3O4/c1-25-19(24)23(26-2)17-6-4-3-5-14(17)13-27-18-11-12-22(21-18)16-9-7-15(20)8-10-16/h3-12H,13H2,1-2H3
Chave InChI:InChIKey=HZRSNVGNWUDEFX-UHFFFAOYSA-N
SMILES:COC(=O)N(OC)c1ccccc1COc1ccn(-c2ccc(Cl)cc2)n1
Consulta técnica sobre Pyraclostrobin
Por favor, utilize o carrinho para solicitar um orçamento ou uma encomenda
Por favor, utilize o carrinho para solicitar um orçamento ou uma encomenda. Se desejar solicitar um orçamento ou fazer uma encomenda, por favor, adicione os produtos ao seu carrinho e depois solicite um orçamento ou encomenda a partir do carrinho. É mais rápido, mais barato e poderá beneficiar-se dos descontos e outras vantagens disponíveis.