Informação sobre produto
Nome:4-Pyridazinecarboxylic acid
Sinónimos:
- 1(2H)-Pyrazinecarboxylic acidPyrzine-4-carboxylic acid
Marca:Biosynth
Descrição:4-Pyridazinecarboxylic acid is a salt that contains sodium. It is a white crystalline solid that is soluble in water, ethanol, and acetone. It has been shown to be effective against Leishmania species and Cryptococcus neoformans. 4-Pyridazinecarboxylic acid inhibits the growth of these fungi by binding to their cell membrane and inhibiting protein synthesis. 4-Pyridazinecarboxylic acid forms coordination complexes with metal ions that are involved in electron transfer reactions during the oxidative phosphorylation process. This leads to a decrease in ATP production and an increase in reactive oxygen species (ROS), which disrupts the function of macrophages and other phagocytic cells, leading to immunosuppression.
Aviso:Os nossos productos estão destinados exclusivamente para uso em laboratório. Para qualquer outra aplicação, por favor entre em contacto.
Propriedades químicas
Peso molecular:124.1 g/mol
Fórmula:C5H4N2O2
Pureza:Min. 95%
InChI:InChI=1S/C5H4N2O2/c8-5(9)4-1-2-6-7-3-4/h1-3H,(H,8,9)
Chave InChI:InChIKey=JUSIWJONLKBPDU-UHFFFAOYSA-N
SMILES:O=C(O)c1ccnnc1
Consulta técnica sobre 4-Pyridazinecarboxylic acid
Por favor, utilize o carrinho para solicitar um orçamento ou uma encomenda
Se desejar solicitar um orçamento ou efetuar uma encomenda, adicione, por favor, os produtos pretendidos ao carrinho e faça a gestão do pedido a partir daí. É mais rápido, mais económico e poderá beneficiar dos descontos e das vantagens disponíveis.
