

Informação sobre produto
Nome:Phenoxypropionic acid
Marca:Biosynth
Descrição:Phenoxypropionic acid is a nitro compound that has been shown to inhibit the growth of bacteria by inhibiting their DNA synthesis. A sample preparation process involving UV absorption and the use of wild-type strains was used to determine the effects of this drug on bacterial DNA. The carbonyl group, amide, and methyl ethyl groups found in phenoxypropionic acid are responsible for its inhibitory activity against bacteria. Phenoxypropionic acid has been shown to have site-specific binding properties when it interacts with the mitochondrial membrane potential. This effect may be due to its ability to form an acid-complex with phosphorus pentoxide, which leads to a decrease in mitochondrial membrane potential and subsequent cell death. Phenoxypropionic acid also binds with enantiomers that differ only in the orientation of their chiral carbon atom. This binding is dependent on pH, resulting in different concentrations of enantiomers at different pH levels.
Aviso:Os nossos productos estão destinados exclusivamente para uso em laboratório. Para qualquer outra aplicação, por favor entre em contacto.
Propriedades químicas
Peso molecular:166.17 g/mol
Fórmula:C9H10O3
Pureza:Min. 95%
InChI:InChI=1S/C9H10O3/c10-9(11)6-7-12-8-4-2-1-3-5-8/h1-5H,6-7H2,(H,10,11)
Chave InChI:InChIKey=BUSOTUQRURCMCM-UHFFFAOYSA-N
SMILES:O=C(O)CCOc1ccccc1