

Informação sobre produto
Nome:(Phenylthio)acetic Acid
Sinónimos:
- (Phenylmercapto)acetic AcidS-Phenylthioglycolic AcidThiophenoxyacetic Acid
Marca:Biosynth
Descrição:Phenylthioacetic acid is a blood disorder drug that is used to treat high blood pressure and heart failure. It belongs to the group of drugs called thiocarboxylic acids. The reaction mechanism of phenylthioacetic acid involves the loss of hydrogen sulfide, which occurs by an addition-elimination reaction with hydroxide ions. Phenylthioacetic acid also has antihypertensive activity and inhibits malonic acid synthesis in the mitochondria by blocking the oxidation of malonyl-CoA. This drug binds to human serum albumin and consequently has a low therapeutic index, making it unsuitable for use in patients with liver or kidney disease. Structural data shows that phenylthioacetic acid exists as a zwitterion at physiological pH and that its asymmetric carbon atom is bound to two different groups: pyridine nitrogen (N) and an acyl chain. X-ray crystal structures show that the car
Aviso:Os nossos productos estão destinados exclusivamente para uso em laboratório. Para qualquer outra aplicação, por favor entre em contacto.
Propriedades químicas
Peso molecular:168.21 g/mol
Fórmula:C8H8O2S
Pureza:Min. 95%
InChI:InChI=1S/C8H8O2S/c9-8(10)6-11-7-4-2-1-3-5-7/h1-5H,6H2,(H,9,10)
Chave InChI:InChIKey=MOTOSAGBNXXRRE-UHFFFAOYSA-N
SMILES:O=C(O)CSc1ccccc1