

Informação sobre produto
Nome:Picene (purified by sublimation)
Sinónimos:
- Benzo[a]chrysene (purified by sublimation)
Marca:Biosynth
Descrição:Picene is a chemical compound that has been purified by sublimation. It has a molecular weight of 116.07 and a UV absorption maximum at 230 nm, which is the wavelength of light used to measure its concentration in the atmosphere. Picene is also soluble in most organic solvents and reacts with oxygen to form picene oxide, which is insoluble. The molecule consists of three benzene rings linked together by methoxy groups. Picene can undergo oxidation reactions, such as the conversion of chlorine atoms to chloride ions or the formation of reaction intermediates like chloromethyl groups through nucleophilic substitution reactions. Picene is chemically stable and does not react with strong acids or bases.
Aviso:Os nossos productos estão destinados exclusivamente para uso em laboratório. Para qualquer outra aplicação, por favor entre em contacto.
Propriedades químicas
Peso molecular:278.35 g/mol
Fórmula:C22H14
Pureza:Min. 95%
InChI:InChI=1S/C22H14/c1-3-7-17-15(5-1)9-11-21-19(17)13-14-20-18-8-4-2-6-16(18)10-12-22(20)21/h1-14H
Chave InChI:InChIKey=GBROPGWFBFCKAG-UHFFFAOYSA-N
SMILES:c1ccc2c(c1)ccc1c2ccc2c3ccccc3ccc21