Informação sobre produto
Nome:Sakuranetin
Sinónimos:
- 4',5-Dihydroxy-7-methoxyflavanone
Marca:Biosynth
Descrição:Sakuranetin is a flavonoid, which is a natural compound derived predominantly from cherry blossoms and various citrus plants. As a phytochemical, it is primarily sourced from plants where it functions as a natural defense mechanism against environmental stressors. The mode of action of sakuranetin involves the inhibition of key pro-inflammatory pathways, notably blocking the activation of NF-κB, a protein complex that plays a crucial role in controlling the transcription of DNA, cytokine production, and cell survival.
Aviso:Os nossos productos estão destinados exclusivamente para uso em laboratório. Para qualquer outra aplicação, por favor entre em contacto.
Propriedades químicas
Peso molecular:286.28 g/mol
Fórmula:C16H14O5
Pureza:Min. 95%
Cor/forma:Powder
InChI:InChI=1S/C16H14O5/c1-20-11-6-12(18)16-13(19)8-14(21-15(16)7-11)9-2-4-10(17)5-3-9/h2-7,14,17-18H,8H2,1H3
Chave InChI:InChIKey=DJOJDHGQRNZXQQ-UHFFFAOYSA-N
SMILES:COc1cc(O)c2c(c1)OC(c1ccc(O)cc1)CC2=O
Consulta técnica sobre Sakuranetin
Por favor, utilize o carrinho para solicitar um orçamento ou uma encomenda
Por favor, utilize o carrinho para solicitar um orçamento ou uma encomenda. Se desejar solicitar um orçamento ou fazer uma encomenda, por favor, adicione os produtos ao seu carrinho e depois solicite um orçamento ou encomenda a partir do carrinho. É mais rápido, mais barato e poderá beneficiar-se dos descontos e outras vantagens disponíveis.