Informação sobre produto
Nome:Trityl chloride
Sinónimos:
- Triphenylmethyl chloride
- Chlorotriphenylmethane
Marca:Biosynth
Descrição:Trityl chloride is an organic compound that has high chemical stability. It is mainly used as a reagent in organic synthesis and polymer chemistry. Trityl chloride reacts with alkanoic acids to form esters by the reaction of the acid chloride with alcohols. Trityl chloride reacts with trifluoroacetic acid to form carboxylic acid chlorides, which are often used as chiral synthons in asymmetric synthesis. The coordination geometry of the trityl ligand is octahedral and it binds to metal cations through three oxygen atoms and two adjacent nitrogen atoms. The polymer compositions can be chiral due to the presence of chiral trityl groups, which can lead to different physical properties such as solubility or melting point.
Aviso:Os nossos productos estão destinados exclusivamente para uso em laboratório. Para qualquer outra aplicação, por favor entre em contacto.
Propriedades químicas
Peso molecular:278.78 g/mol
Fórmula:C19H15Cl
Pureza:(¹H-Nmr) Min. 95 Area-%
Cor/forma:White Powder
InChI:InChI=1S/C19H15Cl/c20-19(16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-15H
Chave InChI:InChIKey=JBWKIWSBJXDJDT-UHFFFAOYSA-N
SMILES:ClC(c1ccccc1)(c1ccccc1)c1ccccc1
Consulta técnica sobre Trityl chloride
Por favor, utilize o carrinho para solicitar um orçamento ou uma encomenda
Por favor, utilize o carrinho para solicitar um orçamento ou uma encomenda. Se desejar solicitar um orçamento ou fazer uma encomenda, por favor, adicione os produtos ao seu carrinho e depois solicite um orçamento ou encomenda a partir do carrinho. É mais rápido, mais barato e poderá beneficiar-se dos descontos e outras vantagens disponíveis.