

Informação sobre produto
Nome:Triethylborane - 1M in THF
Marca:Biosynth
Descrição:Triethylborane (TEB) is a compound that is used as an oxidant in organic synthesis. It is also used for the synthesis of other compounds, such as epoxides, asymmetric syntheses, and hydroxylation reactions. TEB has been shown to be highly resistant to repair mechanisms. The nitrogen atoms are present in a form of triethylamine borane or triethylamine borane-1M in THF. This compound can be used to study both infectious diseases and biological processes. TEB reacts with malonic acid to produce boric acid and epoxides. The reaction mechanism involves an acid complex that forms between the carboxylic acid and the hydroxyl group on the TEB molecule.
Aviso:Os nossos productos estão destinados exclusivamente para uso em laboratório. Para qualquer outra aplicação, por favor entre em contacto.
Propriedades químicas
Peso molecular:97.99 g/mol
Fórmula:C6H15B
Pureza:Min. 95%
InChI:InChI=1S/C6H15B/c1-4-7(5-2)6-3/h4-6H2,1-3H3
Chave InChI:InChIKey=LALRXNPLTWZJIJ-UHFFFAOYSA-N
SMILES:CCB(CC)CC