Informação sobre produto
Nome:1,3,5-Trimethoxybenzene
Sinónimos:
- Phloroglucinol trimethyl ether
Marca:Biosynth
Descrição:1,3,5-Trimethoxybenzene is used for the analysis of drugs in human serum and as a precursor to pharmaceuticals. It is also used as a reagent in organic synthesis. Trimethyl 1,3,5-trimethoxybenzene reacts with nitrite ion to produce an unstable intermediate that undergoes hydrolysis to form trifluoroacetic acid and hydrogen gas. The reaction mechanism involves an intramolecular hydrogen transfer from the hydroxyl group of the methoxy benzene ring to the methyl group on carbon 3. This leads to formation of a highly reactive trimethyl cation that abstracts hydrogen from water or hydroxyl groups on nearby molecules and eventually undergoes hydrolysis to produce trifluoroacetic acid and hydrogen gas.
Aviso:Os nossos productos estão destinados exclusivamente para uso em laboratório. Para qualquer outra aplicação, por favor entre em contacto.
Propriedades químicas
Peso molecular:168.19 g/mol
Fórmula:C9H12O3
Pureza:Min. 98.5%
Cor/forma:White Powder
InChI:InChI=1S/C9H12O3/c1-10-7-4-8(11-2)6-9(5-7)12-3/h4-6H,1-3H3
Chave InChI:InChIKey=LKUDPHPHKOZXCD-UHFFFAOYSA-N
SMILES:COc1cc(OC)cc(OC)c1
Consulta técnica sobre 1,3,5-Trimethoxybenzene
Por favor, utilize o carrinho para solicitar um orçamento ou uma encomenda
Por favor, utilize o carrinho para solicitar um orçamento ou uma encomenda. Se desejar solicitar um orçamento ou fazer uma encomenda, por favor, adicione os produtos ao seu carrinho e depois solicite um orçamento ou encomenda a partir do carrinho. É mais rápido, mais barato e poderá beneficiar-se dos descontos e outras vantagens disponíveis.