

Informação sobre produto
Nome:2,4,6-triphenyl-1,3,5-triazine
Marca:Biosynth
Descrição:2,4,6-Triphenyl-1,3,5-triazine (TPTZ) is a sodium salt of the triazine. TPTZ has been used in light emitting diodes as a host material. The dihedral of TPTZ is optimized for its emission properties at an optimum concentration of 0.2 M with a reactive site that is activated by UV radiation and reacts through a mechanism involving the formation of reactive oxygen species. It has transport properties that are hindered by low energy molecules such as diphenyl ethers or basic structures like molecules containing nitrogen atoms or phosphorous atoms. The structural analysis of TPTZ shows that it contains three phenyl groups and two nitrogens in its molecular structure.
Aviso:Os nossos productos estão destinados exclusivamente para uso em laboratório. Para qualquer outra aplicação, por favor entre em contacto.
Propriedades químicas
Peso molecular:309.36 g/mol
Fórmula:C21H15N3
Pureza:Min. 95%
InChI:InChI=1S/C21H15N3/c1-4-10-16(11-5-1)19-22-20(17-12-6-2-7-13-17)24-21(23-19)18-14-8-3-9-15-18/h1-15H
Chave InChI:InChIKey=HBQUOLGAXBYZGR-UHFFFAOYSA-N
SMILES:c1ccc(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)cc1