Informação sobre produto
Nome:Tricetin
Sinónimos:
- 5,7,3',4',5'-Pentahydroxyflavone
Marca:Biosynth
Descrição:Tricetin is a naturally occurring flavonoid compound, which is primarily sourced from various plant species. Its molecular structure comprises multiple hydroxyl groups, contributing to its biological activity. Tricetin functions by modulating several biochemical pathways; it exhibits antioxidant properties through scavenging of reactive oxygen species and chelation of metal ions. Additionally, Tricetin possesses anti-inflammatory effects, as it can inhibit the synthesis of pro-inflammatory cytokines and downregulate the expression of enzymes involved in inflammation, such as cyclooxygenase and lipoxygenase.
Aviso:Os nossos productos estão destinados exclusivamente para uso em laboratório. Para qualquer outra aplicação, por favor entre em contacto.
Propriedades químicas
Peso molecular:302.24 g/mol
Fórmula:C15H10O7
Pureza:Min. 95%
Cor/forma:Yellow Powder
InChI:InChI=1S/C15H10O7/c16-7-3-8(17)14-9(18)5-12(22-13(14)4-7)6-1-10(19)15(21)11(20)2-6/h1-5,16-17,19-21H
Chave InChI:InChIKey=ARSRJFRKVXALTF-UHFFFAOYSA-N
SMILES:O=c1cc(-c2cc(O)c(O)c(O)c2)oc2cc(O)cc(O)c12
Consulta técnica sobre Tricetin
Por favor, utilize o carrinho para solicitar um orçamento ou uma encomenda
Por favor, utilize o carrinho para solicitar um orçamento ou uma encomenda. Se desejar solicitar um orçamento ou fazer uma encomenda, por favor, adicione os produtos ao seu carrinho e depois solicite um orçamento ou encomenda a partir do carrinho. É mais rápido, mais barato e poderá beneficiar-se dos descontos e outras vantagens disponíveis.
