

Informação sobre produto
Nome:Tropolone Tosylate
Marca:Biosynth
Descrição:Tropolone Tosylate is a fluorescent probe that interacts with nucleophilic sites in the target tissue. It inhibits the nucleophilic attack of water molecules on the substrate, thereby inhibiting matrix metalloproteinase activity. Tropolone Tosylate has been shown to be an inhibitor of macrophage-like cells and hydrogen bonding interactions. The photophysical properties of this compound are due to its nitrogen atoms, which are responsible for absorbing light at a specific wavelength. Tropolone Tosylate is also a good candidate for optical imaging because it can be used as a contrast agent for magnetic resonance imaging (MRI).
Aviso:Os nossos productos estão destinados exclusivamente para uso em laboratório. Para qualquer outra aplicação, por favor entre em contacto.
Propriedades químicas
Peso molecular:276.31 g/mol
Fórmula:C14H12O4S
Pureza:Min. 95%
InChI:InChI=1S/C14H12O4S/c1-11-7-9-12(10-8-11)19(16,17)18-14-6-4-2-3-5-13(14)15/h2-10H,1H3
Chave InChI:InChIKey=AWUMFQREGHLKJB-UHFFFAOYSA-N
SMILES:Cc1ccc(S(=O)(=O)Oc2cccccc2=O)cc1