Informação sobre produto
Nome:Lupinisoflavone A
Sinónimos:
- (+)-Lupinisoflavone A(+)-6-(2,4-Dihydroxyphenyl)-2,3-dihydro-4-hydroxy-2-(1-methylethenyl)-5H-furo[3,2-g][1]benzopyran-5-one
Marca:Biosynth
Descrição:Lupinisoflavone A is a naturally occurring bioactive compound, specifically an isoflavone, which is extracted from the seeds and other parts of lupine plants. The lupine species are known for their rich phytochemical profile, which includes various bioactive compounds with potential health benefits. Lupinisoflavone A is structurally characterized by its isoflavone backbone, contributing to its diverse biological effects.
Aviso:Os nossos productos estão destinados exclusivamente para uso em laboratório. Para qualquer outra aplicação, por favor entre em contacto.
Propriedades químicas
Peso molecular:352.34 g/mol
Fórmula:C20H16O6
Pureza:Min. 95%
InChI:InChI=1S/C20H16O6/c1-9(2)15-6-12-16(26-15)7-17-18(19(12)23)20(24)13(8-25-17)11-4-3-10(21)5-14(11)22/h3-5,7-8,15,21-23H,1,6H2,2H3
Chave InChI:InChIKey=DOGAHANJPKBCGB-UHFFFAOYSA-N
SMILES:C=C(C)C1Cc2c(cc3occ(-c4ccc(O)cc4O)c(=O)c3c2O)O1
Consulta técnica sobre Lupinisoflavone A
Por favor, utilize o carrinho para solicitar um orçamento ou uma encomenda
Por favor, utilize o carrinho para solicitar um orçamento ou uma encomenda. Se desejar solicitar um orçamento ou fazer uma encomenda, por favor, adicione os produtos ao seu carrinho e depois solicite um orçamento ou encomenda a partir do carrinho. É mais rápido, mais barato e poderá beneficiar-se dos descontos e outras vantagens disponíveis.