Informação sobre produto
Nome:7,8-Methylenedioxycoumarin
Marca:Biosynth
Descrição:7,8-Methylenedioxycoumarin is a furanocoumarin compound, which is a type of organic molecule characterized by a coumarin core with an additional methylenedioxy group. It is primarily sourced from various plant species, particularly those in the Rutaceae family, where it is found in essential oils and extracts. The mode of action of 7,8-Methylenedioxycoumarin involves its natural fluorescing properties, making it highly valuable for use in various biochemical assays where visualization is key. Due to its unique chemical structure, it efficiently absorbs ultraviolet light and emits visible fluorescence, which is exploited in photochemistry and as a biological marker. Its applications extend to the fields of pharmaceuticals and environmental sciences, where it serves in drug development studies and as a tool for tracking organic pollutants in ecosystems. Researchers continue to explore its potential uses due to its distinctive chemical behavior and natural origin.
Aviso:Os nossos productos estão destinados exclusivamente para uso em laboratório. Para qualquer outra aplicação, por favor entre em contacto.
Propriedades químicas
Peso molecular:190.15 g/mol
Fórmula:C10H6O4
Pureza:Min. 95%
InChI:InChI=1S/C10H6O4/c11-8-4-2-6-1-3-7-10(9(6)14-8)13-5-12-7/h1-4H,5H2
Chave InChI:InChIKey=OZRUEXJYRHKIJC-UHFFFAOYSA-N
SMILES:O=c1ccc2ccc3c(c2o1)OCO3
Consulta técnica sobre 7,8-Methylenedioxycoumarin
Por favor, utilize o carrinho para solicitar um orçamento ou uma encomenda
Por favor, utilize o carrinho para solicitar um orçamento ou uma encomenda. Se desejar solicitar um orçamento ou fazer uma encomenda, por favor, adicione os produtos ao seu carrinho e depois solicite um orçamento ou encomenda a partir do carrinho. É mais rápido, mais barato e poderá beneficiar-se dos descontos e outras vantagens disponíveis.