CAS 1000018-44-9: 5-(2,6-Dimethyl-4-morpholinyl)-2-nitrobenzoic acid
Description:5-(2,6-Dimethyl-4-morpholinyl)-2-nitrobenzoic acid is a chemical compound characterized by its complex structure, which includes a nitro group, a benzoic acid moiety, and a morpholine ring. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and solubility characteristics. The presence of the nitro group suggests that it may participate in electrophilic substitution reactions, while the benzoic acid component indicates acidic properties, allowing it to donate protons in solution. The morpholine ring, which contains both nitrogen and oxygen, can influence the compound's polarity and hydrogen bonding capabilities, potentially enhancing its solubility in polar solvents. Additionally, the dimethyl substitution on the aromatic ring can affect steric hindrance and electronic distribution, impacting the compound's overall reactivity and interaction with biological systems. Overall, this compound may have applications in pharmaceuticals or as an intermediate in organic synthesis, although specific applications would depend on further research and characterization.
Formula:C13H16N2O5
InChI:InChI=1S/C13H16N2O5/c1-8-6-14(7-9(2)20-8)10-3-4-12(15(18)19)11(5-10)13(16)17/h3-5,8-9H,6-7H2,1-2H3,(H,16,17)
InChI key:InChIKey=VWTUGTCIUKZKLA-UHFFFAOYSA-N
SMILES:O=C(O)C1=CC(=CC=C1N(=O)=O)N2CC(OC(C)C2)C
- Synonyms:
- 2-Nitro-5-(2,6-dimethylmorpholin-4-yl)benzoic acid
- 5-(2,6-Dimethyl-4-morpholinyl)-2-nitrobenzoic acid
- Benzoic acid, 5-(2,6-dimethyl-4-morpholinyl)-2-nitro-
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 5-(2,6-Dimethylmorpholin-4-yl)-2-nitrobenzoic acid REF: 3D-AQB01844CAS: 1000018-44-9 | Min. 95% | - - - | Discontinued product |

5-(2,6-Dimethylmorpholin-4-yl)-2-nitrobenzoic acid
Ref: 3D-AQB01844
5g | Discontinued | Request information | |
10g | Discontinued | Request information |