
CAS 100004-81-7: 3-(2-Methoxyphenyl)-4-pyridinecarboxylic acid
Description:3-(2-Methoxyphenyl)-4-pyridinecarboxylic acid, identified by its CAS number 100004-81-7, is an organic compound characterized by its aromatic structure and functional groups. It features a pyridine ring, which is a six-membered heterocyclic aromatic ring containing one nitrogen atom, and a carboxylic acid group (-COOH) that contributes to its acidity and reactivity. The presence of the methoxyphenyl group enhances its lipophilicity and may influence its biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the carboxylic acid functionality. Its chemical properties allow it to participate in various reactions, such as esterification and amidation, making it useful in synthetic organic chemistry. Additionally, compounds with similar structures are often investigated for their potential pharmacological activities, including anti-inflammatory and antimicrobial properties. Overall, 3-(2-Methoxyphenyl)-4-pyridinecarboxylic acid is a versatile compound with applications in research and development within the fields of medicinal chemistry and materials science.
Formula:C13H11NO3
InChI:InChI=1S/C13H11NO3/c1-17-12-5-3-2-4-9(12)11-8-14-7-6-10(11)13(15)16/h2-8H,1H3,(H,15,16)
InChI key:InChIKey=MEYHBIZGGUXZHE-UHFFFAOYSA-N
SMILES:O=C(O)C1=CC=NC=C1C=2C=CC=CC2OC
- Synonyms:
- 3-(2-Methoxyphenyl)-4-pyridinecarboxylic acid
- 4-Pyridinecarboxylic acid, 3-(2-methoxyphenyl)-
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 4-Pyridinecarboxylic acid, 3-(2-methoxyphenyl)- REF: IN-DA00H944CAS: 100004-81-7 | 95% | 154.00 €~524.00 € | Thu 27 Mar 25 |
![]() | 3-(2-Methoxyphenyl)isonicotinic acid REF: 10-F783530CAS: 100004-81-7 | 98% | To inquire | Tue 08 Apr 25 |
![]() | 3-(2-Methoxyphenyl)isonicotinic acid REF: 3D-AEA00481CAS: 100004-81-7 | Min. 95% | - - - | Discontinued product |

4-Pyridinecarboxylic acid, 3-(2-methoxyphenyl)-
Ref: IN-DA00H944
1g | 524.00 € | ||
100mg | 154.00 € | ||
250mg | 198.00 € | ||
500mg | 276.00 € |

Ref: 10-F783530
100mg | To inquire | ||
250mg | To inquire |

3-(2-Methoxyphenyl)isonicotinic acid
Ref: 3D-AEA00481
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |