CAS 1000339-79-6: Ethyl 2-(1-pyrrolidinyl)-4-(trifluoromethyl)-5-thiazolecarboxylate
Description:Ethyl 2-(1-pyrrolidinyl)-4-(trifluoromethyl)-5-thiazolecarboxylate is a chemical compound characterized by its unique structural features, which include a thiazole ring, a pyrrolidine moiety, and a trifluoromethyl group. The presence of the thiazole ring contributes to its potential biological activity, as thiazoles are often found in various pharmaceuticals and agrochemicals. The trifluoromethyl group enhances lipophilicity and can influence the compound's reactivity and interaction with biological targets. Ethyl esters, such as this compound, typically exhibit moderate to high solubility in organic solvents, while their solubility in water can vary. The compound may also exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in areas targeting neurological or metabolic pathways. However, specific biological activity and safety profiles would require further investigation through experimental studies.
Formula:C11H13F3N2O2S
InChI:InChI=1S/C11H13F3N2O2S/c1-2-18-9(17)7-8(11(12,13)14)15-10(19-7)16-5-3-4-6-16/h2-6H2,1H3
InChI key:InChIKey=UFCVXWWKIIUOGF-UHFFFAOYSA-N
SMILES:O=C(OCC)C=1SC(=NC1C(F)(F)F)N2CCCC2
- Synonyms:
- Ethyl 2-(1-pyrrolidinyl)-4-(trifluoromethyl)-5-thiazolecarboxylate
- 5-Thiazolecarboxylic acid, 2-(1-pyrrolidinyl)-4-(trifluoromethyl)-, ethyl ester
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Ethyl 2-(pyrrolidin-1-yl)-4-(trifluoromethyl)-1,3-thiazole-5-carboxylate REF: 54-PC7558CAS: 1000339-79-6 | - - - | To inquire | Tue 08 Jul 25 |
![]() | Ethyl 2-(pyrrolidin-1-yl)-4-(trifluoromethyl)-1,3-thiazole-5-carboxylate REF: 3D-AQB33979CAS: 1000339-79-6 | Min. 95% | - - - | Discontinued product |

Ethyl 2-(pyrrolidin-1-yl)-4-(trifluoromethyl)-1,3-thiazole-5-carboxylate
Ref: 54-PC7558
Undefined size | To inquire |

Ethyl 2-(pyrrolidin-1-yl)-4-(trifluoromethyl)-1,3-thiazole-5-carboxylate
Ref: 3D-AQB33979
5g | Discontinued | Request information | |
10g | Discontinued | Request information |