CAS 1000340-01-1: 3,5-Dibromo-2-fluoro-4-methylpyridine
Description:3,5-Dibromo-2-fluoro-4-methylpyridine is a heterocyclic organic compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. The presence of bromine and fluorine substituents at specific positions on the ring significantly influences its chemical properties and reactivity. The compound features two bromine atoms at the 3 and 5 positions, a fluorine atom at the 2 position, and a methyl group at the 4 position, contributing to its unique electronic and steric characteristics. This substitution pattern can enhance its reactivity in nucleophilic substitution reactions and may also affect its solubility and polarity. 3,5-Dibromo-2-fluoro-4-methylpyridine is of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential applications in the synthesis of biologically active compounds. Additionally, its halogenated nature may impart specific properties such as increased lipophilicity or altered biological activity, making it a valuable compound for further research and development.
Formula:C6H4Br2FN
InChI:InChI=1S/C6H4Br2FN/c1-3-4(7)2-10-6(9)5(3)8/h2H,1H3
InChI key:InChIKey=LAOILGACTMFPSZ-UHFFFAOYSA-N
SMILES:FC1=NC=C(Br)C(=C1Br)C
- Synonyms:
- 3,5-Dibromo-2-fluoro-4-picoline
- Pyridine, 3,5-dibromo-2-fluoro-4-methyl-
- 3,5-Dibromo-2-fluoro-4-methylpyridine

Pyridine, 3,5-dibromo-2-fluoro-4-methyl-
Ref: IN-DA0000DA
5g | 145.00 € | ||
10g | 245.00 € |

Ref: 54-PC9264
1g | 64.00 € |

Ref: 10-F036171
1g | To inquire |

3,5-Dibromo-2-fluoro-4-methylpyridine
Ref: 3D-FD07745
100g | Discontinued | Request information |