CAS 1000340-38-4: 4-Chloro-1H-pyrrolo[2,3-b]pyridin-3-amine
Description:4-Chloro-1H-pyrrolo[2,3-b]pyridin-3-amine is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. The presence of a chlorine atom at the 4-position and an amino group at the 3-position enhances its reactivity and solubility in various solvents. This compound typically exhibits a moderate to high melting point and is soluble in polar organic solvents, making it suitable for various applications in medicinal chemistry and material science. Its structure allows for potential interactions with biological targets, which may lead to pharmacological activity. Additionally, the compound may participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions, due to the presence of the amino group. Overall, 4-Chloro-1H-pyrrolo[2,3-b]pyridin-3-amine is of interest in research and development, particularly in the synthesis of novel pharmaceuticals and agrochemicals.
Formula:C7H6ClN3
InChI:InChI=1S/C7H6ClN3/c8-4-1-2-10-7-6(4)5(9)3-11-7/h1-3H,9H2,(H,10,11)
InChI key:InChIKey=YKPPFTFSPGZWLB-UHFFFAOYSA-N
SMILES:ClC1=CC=NC=2NC=C(N)C12
- Synonyms:
- 4-Chloro-1H-pyrrolo[2,3-b]pyridin-3-amine
- 1H-Pyrrolo[2,3-b]pyridin-3-amine, 4-chloro-
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 1H-Pyrrolo[2,3-b]pyridin-3-amine, 4-chloro- REF: IN-DA0000DWCAS: 1000340-38-4 | 97% | To inquire | Wed 07 May 25 |
![]() | 4-Chloro-1H-pyrrolo[2,3-b]pyridin-3-amine REF: 10-F227891CAS: 1000340-38-4 | 95.0% | To inquire | Mon 19 May 25 |

1H-Pyrrolo[2,3-b]pyridin-3-amine, 4-chloro-
Ref: IN-DA0000DW
Undefined size | To inquire |

4-Chloro-1H-pyrrolo[2,3-b]pyridin-3-amine
Ref: 10-F227891
1g | To inquire | ||
250mg | To inquire |