
CAS 100047-41-4: 1,5-Dihydro-4-(methylthio)-6H-pyrazolo[3,4-d]pyrimidin-6-one
Description:1,5-Dihydro-4-(methylthio)-6H-pyrazolo[3,4-d]pyrimidin-6-one, with the CAS number 100047-41-4, is a heterocyclic compound characterized by its pyrazolo-pyrimidine structure. This compound features a fused ring system that includes both pyrazole and pyrimidine moieties, contributing to its unique chemical properties. The presence of a methylthio group enhances its reactivity and solubility in organic solvents. Typically, compounds of this class exhibit biological activity, making them of interest in medicinal chemistry and drug development. They may interact with various biological targets, potentially influencing cellular processes. The compound's molecular structure suggests it may participate in hydrogen bonding and other intermolecular interactions, which are crucial for its biological activity. Additionally, its stability and reactivity can be influenced by the substituents on the ring system, making it a subject of study for its potential therapeutic applications. Overall, 1,5-Dihydro-4-(methylthio)-6H-pyrazolo[3,4-d]pyrimidin-6-one represents a significant compound in the realm of organic and medicinal chemistry.
Formula:C6H6N4OS
InChI:InChI=1S/C6H6N4OS/c1-12-5-3-2-7-10-4(3)8-6(11)9-5/h2H,1H3,(H2,7,8,9,10,11)
InChI key:InChIKey=KCPACWMYSQDQHA-UHFFFAOYSA-N
SMILES:O=C1N=C(SC)C=2C=NNC2N1
- Synonyms:
- 1H-Pyrazolo[3,4-d]pyrimidin-6-ol, 4-(methylthio)-
- 1,5-Dihydro-4-(methylthio)-6H-pyrazolo[3,4-d]pyrimidin-6-one
- 6H-Pyrazolo[3,4-d]pyrimidin-6-one, 1,5-dihydro-4-(methylthio)-
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 6H-Pyrazolo[3,4-d]pyrimidin-6-one, 1,5-dihydro-4-(methylthio)- REF: IN-DA0000NKCAS: 100047-41-4 | - - - | To inquire | Fri 30 May 25 |
![]() | 4-(Methylthio)-1H-pyrazolo[3,4-d]pyrimidin-6-ol REF: 3D-AEA04741CAS: 100047-41-4 | Min. 95% | - - - | Discontinued product |

6H-Pyrazolo[3,4-d]pyrimidin-6-one, 1,5-dihydro-4-(methylthio)-
Ref: IN-DA0000NK
Undefined size | To inquire |

4-(Methylthio)-1H-pyrazolo[3,4-d]pyrimidin-6-ol
Ref: 3D-AEA04741
5g | Discontinued | Request information | |
10g | Discontinued | Request information |