CAS 1000802-51-6: 1-[2-[4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazol-1-yl]ethyl]piperidine
Description:1-[2-[4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazol-1-yl]ethyl]piperidine is a chemical compound characterized by its complex structure, which includes a piperidine ring and a pyrazole moiety linked through an ethyl group. The presence of a boron-containing dioxaborolane group contributes to its unique reactivity and potential applications in organic synthesis, particularly in the formation of carbon-boron bonds. This compound is likely to exhibit moderate to high polarity due to the presence of heteroatoms and functional groups, influencing its solubility in various solvents. Additionally, the tetramethyl substituents on the dioxaborolane enhance its stability and steric hindrance, which can affect its reactivity in chemical reactions. The compound may also exhibit biological activity, making it of interest in medicinal chemistry. Overall, its structural features suggest potential utility in both synthetic and pharmaceutical chemistry, although specific applications would depend on further research and characterization.
Formula:C16H28BN3O2
InChI:InChI=1S/C16H28BN3O2/c1-15(2)16(3,4)22-17(21-15)14-12-18-20(13-14)11-10-19-8-6-5-7-9-19/h12-13H,5-11H2,1-4H3
InChI key:InChIKey=CUDGRVPQYNPZOL-UHFFFAOYSA-N
SMILES:N1=CC(=CN1CCN2CCCCC2)B3OC(C)(C)C(O3)(C)C
- Synonyms:
- 1-[2-(1-Piperidyl)ethyl]-1H-pyrazole-4-boronic acid pinacol ester
- 1-[2-[4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazol-1-yl]ethyl]piperidine
- Piperidine, 1-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazol-1-yl]ethyl]-

1-[2-(1-Piperidyl)ethyl]-1H-pyrazole-4-boronicAcidPinacolEster
Ref: IN-DA01DFBK
1g | To inquire | ||
100mg | 194.00 € | ||
250mg | 289.00 € |

1-(2-(4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazol-1-yl)ethyl)piperidine
Ref: 10-F694619
1g | To inquire | ||
100mg | To inquire | ||
250mg | To inquire |

1-[2-(1-Piperidyl)ethyl]-1H-pyrazole-4-boronic Acid Pinacol Ester
Ref: 3D-AQB80251
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |