CAS 100142-73-2: 3-(1-PHENYL-1H-PYRAZOL-4-YL)PROPANOIC ACID
Description:3-(1-Phenyl-1H-pyrazol-4-yl)propanoic acid, with the CAS number 100142-73-2, is an organic compound characterized by its unique structure that includes a propanoic acid moiety and a phenyl-substituted pyrazole ring. This compound typically exhibits properties associated with both carboxylic acids and heterocyclic compounds. It is likely to be a white to off-white solid at room temperature, with moderate solubility in polar solvents such as water and alcohols, while being less soluble in non-polar solvents. The presence of the carboxylic acid group suggests it can participate in acid-base reactions, while the pyrazole ring may contribute to its potential biological activity, possibly acting as a ligand in coordination chemistry or as a pharmacophore in medicinal chemistry. Additionally, the compound may exhibit specific melting and boiling points, as well as distinct spectral characteristics in techniques such as NMR and IR spectroscopy, which can be used for its identification and characterization.
Formula:C12H12N2O2
InChI:InChI=1/C12H12N2O2/c15-12(16)7-6-10-8-13-14(9-10)11-4-2-1-3-5-11/h1-5,8-9H,6-7H2,(H,15,16)
- Synonyms:
- 3-(1-phenyl-1H-pyrazol-4-yl)propanoate

1H-Pyrazole-4-propanoic acid, 1-phenyl-
Ref: IN-DA00013Q
100mg | 173.00 € | ||
250mg | 284.00 € |

3-(1-Phenyl-1h-pyrazol-4-yl)propanoic acid
Ref: 10-F656679
100mg | 175.00 € | ||
250mg | 258.00 € |

3-(1-Phenyl-1H-pyrazol-4-yl)propanoic acid
Ref: 3D-AEA14273
50mg | Discontinued | Request information | |
500mg | Discontinued | Request information |