CAS 1001756-37-1: 4-Ethyl-2,4-dihydro-5-[1-methyl-5-(trifluoromethyl)-1H-pyrazol-3-yl]-3H-1,2,4-triazole-3-thione
Description:4-Ethyl-2,4-dihydro-5-[1-methyl-5-(trifluoromethyl)-1H-pyrazol-3-yl]-3H-1,2,4-triazole-3-thione is a chemical compound characterized by its complex structure, which includes a triazole ring and a pyrazole moiety. This compound features a thione functional group, indicating the presence of sulfur, which contributes to its reactivity and potential biological activity. The trifluoromethyl group enhances lipophilicity and may influence the compound's pharmacokinetic properties. The ethyl substituent adds to the steric bulk, potentially affecting interactions with biological targets. This compound is of interest in medicinal chemistry and agricultural applications, particularly as a fungicide or herbicide, due to its ability to inhibit specific enzymatic pathways in target organisms. Its synthesis typically involves multi-step organic reactions, and its stability, solubility, and reactivity can vary based on environmental conditions. As with many heterocyclic compounds, it may exhibit unique properties such as fluorescence or specific binding affinities, making it a subject of study in various fields, including pharmaceuticals and agrochemicals.
Formula:C9H10F3N5S
InChI:InChI=1S/C9H10F3N5S/c1-3-17-7(13-14-8(17)18)5-4-6(9(10,11)12)16(2)15-5/h4H,3H2,1-2H3,(H,14,18)
InChI key:InChIKey=MQLMDWGOVXPPFA-UHFFFAOYSA-N
SMILES:FC(F)(F)C1=CC(=NN1C)C2=NNC(=S)N2CC
- Synonyms:
- 3H-1,2,4-Triazole-3-thione, 4-ethyl-2,4-dihydro-5-[1-methyl-5-(trifluoromethyl)-1H-pyrazol-3-yl]-
- 4-Ethyl-2,4-dihydro-5-[1-methyl-5-(trifluoromethyl)-1H-pyrazol-3-yl]-3H-1,2,4-triazole-3-thione
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 4-Ethyl-5-(1-methyl-5-trifluoromethyl-1H-pyrazol-3-yl)-4H-[1,2,4]triazole-3-thiol REF: 10-F026008CAS: 1001756-37-1 | - - - | - - - | Discontinued product |
![]() | 4-Ethyl-5-(1-methyl-5-trifluoromethyl-1H-pyrazol-3-yl)-4H-[1,2,4]triazole-3-thiol REF: 3D-BQB75637CAS: 1001756-37-1 | Min. 95% | - - - | Discontinued product |

4-Ethyl-5-(1-methyl-5-trifluoromethyl-1H-pyrazol-3-yl)-4H-[1,2,4]triazole-3-thiol
Ref: 10-F026008
1g | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |

4-Ethyl-5-(1-methyl-5-trifluoromethyl-1H-pyrazol-3-yl)-4H-[1,2,4]triazole-3-thiol
Ref: 3D-BQB75637
1g | Discontinued | Request information | |
5mg | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |