CAS 1002309-48-9: 1-Cyclobutyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole
Description:1-Cyclobutyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole is an organic compound characterized by its unique structural features, which include a cyclobutyl group and a pyrazole ring. The presence of the dioxaborolane moiety introduces boron into the structure, which can enhance its reactivity and potential applications in organic synthesis and medicinal chemistry. This compound is likely to exhibit properties typical of pyrazole derivatives, such as potential biological activity, including anti-inflammatory or anti-cancer effects, depending on the substituents and overall molecular architecture. The tetramethyl groups in the dioxaborolane contribute to steric hindrance, which may influence the compound's reactivity and solubility. Additionally, the presence of boron can facilitate coordination with other molecules, making it useful in various chemical reactions, including cross-coupling reactions. Overall, this compound represents a class of boron-containing heterocycles that are of interest in both synthetic and pharmaceutical chemistry.
Formula:C13H21BN2O2
InChI:InChI=1S/C13H21BN2O2/c1-12(2)13(3,4)18-14(17-12)10-8-15-16(9-10)11-6-5-7-11/h8-9,11H,5-7H2,1-4H3
InChI key:InChIKey=OBCTWWFLJFCNPC-UHFFFAOYSA-N
SMILES:N1=CC(=CN1C2CCC2)B3OC(C)(C)C(O3)(C)C
- Synonyms:
- 1-Cyclobutyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole
- 1-Cyclobutyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole
- 1H-Pyrazole, 1-cyclobutyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-

1H-Pyrazole, 1-cyclobutyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
Ref: IN-DA0001AP
1g | 64.00 € | ||
5g | 198.00 € | ||
100mg | 34.00 € | ||
250mg | 42.00 € |

1-Cyclobutyl-1H-pyrazole-4-boronic acid pinacol ester
Ref: 54-OR317114
1g | 52.00 € | ||
5g | 214.00 € | ||
25g | 981.00 € | ||
100g | 3,594.00 € | ||
250mg | 32.00 € |

1-Cyclobutyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole
Ref: 10-F078153
1g | 47.00 € | ||
5g | 172.00 € | ||
10g | 316.00 € | ||
250mg | 25.00 € |

1-Cyclobutyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole
Ref: 3D-FC43414
1g | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |