CAS 1004-65-5: 3-methyl[1,2,4]triazolo[4,3-a]pyridine
Description:3-Methyl[1,2,4]triazolo[4,3-a]pyridine is a heterocyclic compound characterized by its fused triazole and pyridine rings, which contribute to its unique chemical properties. The presence of a methyl group at the 3-position of the triazole ring influences its reactivity and solubility. This compound typically exhibits moderate polarity due to the nitrogen atoms in the triazole and pyridine rings, which can participate in hydrogen bonding and coordination with metal ions. It is often used in medicinal chemistry and research due to its potential biological activities, including antimicrobial and anti-inflammatory properties. The compound's structure allows for various substitution reactions, making it a versatile building block in organic synthesis. Additionally, its stability under standard laboratory conditions makes it suitable for various applications in chemical research and development. Overall, 3-methyl[1,2,4]triazolo[4,3-a]pyridine is an important compound in the field of heterocyclic chemistry, with implications in drug discovery and material science.
Formula:C7H7N3
InChI:InChI=1/C7H7N3/c1-6-8-9-7-4-2-3-5-10(6)7/h2-5H,1H3
- Synonyms:
- 1,2,4-Triazolo[4,3-a]pyridine, 3-methyl-
- 3-Methyl-1,2,4-Triazolo[4,3-A]Pyridine
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 1,2,4-Triazolo[4,3-a]pyridine, 3-methyl- REF: IN-DA0001WRCAS: 1004-65-5 | 98% | To inquire | Thu 27 Mar 25 |
![]() | 3-Methyl-[1,2,4]triazolo[4,3-a]pyridine REF: 10-F228758CAS: 1004-65-5 | 95.0% | 78.00 €~686.00 € | Tue 01 Apr 25 |
![]() | 3-Methyl-[1,2,4]triazolo[4,3-a]pyridine REF: 3D-BAA00465CAS: 1004-65-5 | Min. 95% | - - - | Discontinued product |

1,2,4-Triazolo[4,3-a]pyridine, 3-methyl-
Ref: IN-DA0001WR
1g | 186.00 € | ||
5g | 603.00 € | ||
10g | To inquire | ||
100mg | 76.00 € | ||
250mg | 119.00 € |

Ref: 10-F228758
1g | 114.00 € | ||
5g | 353.00 € | ||
10g | 686.00 € | ||
250mg | 78.00 € |

3-Methyl-[1,2,4]triazolo[4,3-a]pyridine
Ref: 3D-BAA00465
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |