CAS 1004194-62-0: 4-Amino-N-(2-furanylmethyl)-1-methyl-1H-pyrazole-3-carboxamide

Description: 4-Amino-N-(2-furanylmethyl)-1-methyl-1H-pyrazole-3-carboxamide is a chemical compound characterized by its unique structural features, which include a pyrazole ring, an amine group, and a furan moiety. This compound typically exhibits properties such as moderate solubility in polar solvents due to the presence of functional groups that can engage in hydrogen bonding. The presence of the amino and carboxamide groups suggests potential for biological activity, making it of interest in medicinal chemistry. Its molecular structure allows for various interactions, which may contribute to its reactivity and potential applications in pharmaceuticals or agrochemicals. The compound's stability can be influenced by environmental factors such as pH and temperature, and it may undergo various chemical reactions, including substitution and condensation. Overall, 4-Amino-N-(2-furanylmethyl)-1-methyl-1H-pyrazole-3-carboxamide represents a class of compounds that could be explored for their therapeutic potential, particularly in areas related to inflammation or cancer research.

Formula: C₁₀H₁₂N₄O₂

InChI: InChI=1S/C10H12N4O2/c1-14-6-8(11)9(13-14)10(15)12-5-7-3-2-4-16-7/h2-4,6H,5,11H2,1H3,(H,12,15)

InChI key: InChIKey=YMCJHVAPHSNAQN-UHFFFAOYSA-N

SMILES: O=C(NCC=1OC=CC1)C2=NN(C=C2N)C

Synonyms:

• 4-Amino-N-(2-furanylmethyl)-1-methyl-1H-pyrazole-3-carboxamide
• 1H-Pyrazole-3-carboxamide, 4-amino-N-(2-furanylmethyl)-1-methyl-

4-Amino-N-[(furan-2-yl)methyl]-1-methyl-1H-pyrazole-3-carboxamide

CAS: 1004194-62-0

Versatile small molecule scaffold

• Formula: C₁₀H₁₂N₄O₂
• Purity: Min. 95%
• Molecular weight: 220.23 g/mol

4-Amino-1-methyl-1 H -pyrazole-3-carboxylic acid (furan-2-ylmethyl)-amide

CAS: 1004194-62-0

• Molecular weight: 220.23199462890625