CAS 1004451-73-3: 1-[([1,1′-Biphenyl]-2-yloxy)methyl]-3,5-dimethyl-1H-pyrazol-4-amine
Description:1-[([1,1′-Biphenyl]-2-yloxy)methyl]-3,5-dimethyl-1H-pyrazol-4-amine, identified by its CAS number 1004451-73-3, is a chemical compound characterized by its complex structure, which includes a biphenyl moiety and a pyrazole ring. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of the biphenyl group may enhance its lipophilicity, while the pyrazole ring can impart biological activity, making it a candidate for further research in medicinal chemistry. Additionally, the presence of amine functional groups suggests potential for hydrogen bonding and reactivity, which could influence its solubility and interaction with biological targets. Overall, this compound's unique structural features may lead to interesting chemical behavior and biological activity, warranting further investigation into its properties and potential applications.
Formula:C18H19N3O
InChI:InChI=1S/C18H19N3O/c1-13-18(19)14(2)21(20-13)12-22-17-11-7-6-10-16(17)15-8-4-3-5-9-15/h3-11H,12,19H2,1-2H3
InChI key:InChIKey=LUJZBNNHSTZGQI-UHFFFAOYSA-N
SMILES:N1=C(C(N)=C(N1COC=2C=CC=CC2C=3C=CC=CC3)C)C
- Synonyms:
- 1-[([1,1′-Biphenyl]-2-yloxy)methyl]-3,5-dimethyl-1H-pyrazol-4-amine
- 1H-Pyrazol-4-amine, 1-[([1,1′-biphenyl]-2-yloxy)methyl]-3,5-dimethyl-
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 3,5-Dimethyl-1-[(2-phenylphenoxy)methyl]-1H-pyrazol-4-amine REF: 3D-EQB45173CAS: 1004451-73-3 | Min. 95% | To inquire | Thu 08 May 25 |
![]() | 1-(Biphenyl-2-yloxymethyl)-3,5-dimethyl-1 H -pyrazol-4-ylamine REF: 10-F030168CAS: 1004451-73-3 | - - - | - - - | Discontinued product |

3,5-Dimethyl-1-[(2-phenylphenoxy)methyl]-1H-pyrazol-4-amine
Ref: 3D-EQB45173
1g | 1,014.00 € | ||
100mg | 403.00 € |

1-(Biphenyl-2-yloxymethyl)-3,5-dimethyl-1 H -pyrazol-4-ylamine
Ref: 10-F030168
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information |