CAS 1004643-47-3: 5-(1-Ethyl-1H-pyrazol-4-yl)-1,3,4-oxadiazole-2(3H)-thione

Description: 5-(1-Ethyl-1H-pyrazol-4-yl)-1,3,4-oxadiazole-2(3H)-thione is a heterocyclic compound characterized by the presence of both pyrazole and oxadiazole moieties. This compound features a thione functional group, which is a sulfur-containing analogue of a ketone, indicating potential reactivity and biological activity. The structure suggests that it may exhibit properties such as antimicrobial, antifungal, or anticancer activities, common among compounds with similar frameworks. The presence of the ethyl group enhances its lipophilicity, potentially influencing its solubility and bioavailability. Additionally, the compound may participate in various chemical reactions due to the functional groups present, making it of interest in medicinal chemistry and material science. Its CAS number, 1004643-47-3, allows for easy identification and retrieval of information regarding its properties, safety data, and applications in scientific literature. Overall, this compound represents a class of bioactive molecules that could be explored for various therapeutic applications.

Formula: C₇H₈N₄OS

InChI: InChI=1S/C7H8N4OS/c1-2-11-4-5(3-8-11)6-9-10-7(13)12-6/h3-4H,2H2,1H3,(H,10,13)

InChI key: InChIKey=QKERKSQQEPULNN-UHFFFAOYSA-N

SMILES: S=C1OC(=NN1)C=2C=NN(C2)CC

5-(1-Ethyl-1H-pyrazol-4-yl)-[1,3,4]oxadiazole-2-thiol

CAS: 1004643-47-3

• Molecular weight: 196.041881876

5-(1-Ethyl-1H-pyrazol-4-yl)-[1,3,4]oxadiazole-2-thiol

CAS: 1004643-47-3

Versatile small molecule scaffold

• Formula: C₇H₈N₄OS
• Purity: Min. 95%
• Molecular weight: 196.23 g/mol