CAS 100501-60-8: 1,3-Diethyl 2-[[(2,3,4-trifluorophenyl)amino]methylene]propanedioate
Description:1,3-Diethyl 2-[[(2,3,4-trifluorophenyl)amino]methylene]propanedioate, with the CAS number 100501-60-8, is a chemical compound characterized by its unique structure that includes a diethyl ester group and a trifluorophenyl moiety. This compound features a propanedioate backbone, which contributes to its potential reactivity and solubility properties. The presence of the trifluorophenyl group enhances its lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. The amino group attached to the trifluorophenyl ring suggests potential for hydrogen bonding and interaction with biological targets. Additionally, the diethyl ester functionality may provide sites for further chemical modification or reactivity. Overall, this compound's distinctive features, including its fluorinated aromatic system and ester groups, position it as a candidate for various applications, potentially in pharmaceuticals or agrochemicals, where fluorinated compounds often exhibit enhanced properties such as increased metabolic stability or altered pharmacokinetics.
Formula:C14H14F3NO4
InChI:InChI=1S/C14H14F3NO4/c1-3-21-13(19)8(14(20)22-4-2)7-18-10-6-5-9(15)11(16)12(10)17/h5-7,18H,3-4H2,1-2H3
InChI key:InChIKey=KSWGDSAIUPPJIB-UHFFFAOYSA-N
SMILES:O=C(OCC)C(=CNC1=CC=C(F)C(F)=C1F)C(=O)OCC
- Synonyms:
- Diethyl (2,3,4-trifluoroanilino)methylenemalonate
- Propanedioic acid, 2-[[(2,3,4-trifluorophenyl)amino]methylene]-, 1,3-diethyl ester
- 1,3-Diethyl 2-[[(2,3,4-trifluorophenyl)amino]methylene]propanedioate
- Propanedioic acid, [[(2,3,4-trifluorophenyl)amino]methylene]-, diethyl ester
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | diethyl {[(2,3,4-trifluorophenyl)amino]methylene}malonate REF: 10-F368144CAS: 100501-60-8 | 95.0% | - - - | Discontinued product |
![]() | Diethyl {[(2,3,4-Trifluorophenyl)Amino]Methylene}Malonate REF: 3D-FD95154CAS: 100501-60-8 | Min. 95% | - - - | Discontinued product |

diethyl {[(2,3,4-trifluorophenyl)amino]methylene}malonate
Ref: 10-F368144
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information |

Diethyl {[(2,3,4-Trifluorophenyl)Amino]Methylene}Malonate
Ref: 3D-FD95154
2g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information |