
CAS 1006320-13-3: 3-Amino-4-bromo-1H-pyrazole-1-acetic acid
Description:3-Amino-4-bromo-1H-pyrazole-1-acetic acid is a heterocyclic organic compound characterized by the presence of a pyrazole ring, an amino group, and a bromo substituent. This compound features a carboxylic acid functional group, which contributes to its acidic properties. The presence of the amino group indicates potential for hydrogen bonding, enhancing its solubility in polar solvents. The bromine atom introduces a halogen, which can influence the compound's reactivity and stability. Typically, compounds like this may exhibit biological activity, making them of interest in pharmaceutical research. The molecular structure allows for various synthetic modifications, potentially leading to derivatives with enhanced properties. Additionally, the compound's unique combination of functional groups may facilitate interactions with biological targets, making it a candidate for further investigation in medicinal chemistry. Overall, 3-Amino-4-bromo-1H-pyrazole-1-acetic acid is a versatile compound with potential applications in drug development and other fields of chemistry.
Formula:C5H6BrN3O2
InChI:InChI=1S/C5H6BrN3O2/c6-3-1-9(2-4(10)11)8-5(3)7/h1H,2H2,(H2,7,8)(H,10,11)
InChI key:InChIKey=MAJMYYKXYJAGHX-UHFFFAOYSA-N
SMILES:O=C(O)CN1N=C(N)C(Br)=C1
- Synonyms:
- 3-Amino-4-bromo-1H-pyrazole-1-acetic acid
- 1H-Pyrazole-1-acetic acid, 3-amino-4-bromo-
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 2-(3-Amino-4-bromo-1H-pyrazol-1-yl)acetic acid REF: 10-F749526CAS: 1006320-13-3 | 95% | - - - | Discontinued product |
![]() | 2-(3-Amino-4-bromo-1H-pyrazol-1-yl)acetic acid REF: 3D-GQB32013CAS: 1006320-13-3 | Min. 95% | - - - | Discontinued product |

2-(3-Amino-4-bromo-1H-pyrazol-1-yl)acetic acid
Ref: 10-F749526
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |

2-(3-Amino-4-bromo-1H-pyrazol-1-yl)acetic acid
Ref: 3D-GQB32013
25mg | Discontinued | Request information | |
250mg | Discontinued | Request information |