CAS 1006334-21-9: 4-Bromo-1′,5′-dimethyl-3,4′-bi-1H-pyrazole

Description: 4-Bromo-1′,5′-dimethyl-3,4′-bi-1H-pyrazole is a chemical compound characterized by its unique structure, which includes a bi-pyrazole framework with bromine and methyl substituents. This compound typically exhibits a molecular formula that reflects the presence of bromine and two methyl groups attached to the pyrazole rings. It is known for its potential applications in medicinal chemistry and as a building block in organic synthesis due to its heterocyclic nature. The presence of the bromine atom can influence the compound's reactivity and solubility, making it a subject of interest in various chemical reactions. Additionally, the dimethyl groups contribute to the compound's steric properties, which can affect its interactions with biological targets. As with many pyrazole derivatives, it may exhibit biological activity, including potential anti-inflammatory or anti-cancer properties, although specific biological data would depend on empirical studies. Overall, 4-Bromo-1′,5′-dimethyl-3,4′-bi-1H-pyrazole represents a versatile compound in the realm of organic and medicinal chemistry.

Formula: C₈H₉BrN₄

InChI: InChI=1S/C8H9BrN4/c1-5-6(3-11-13(5)2)8-7(9)4-10-12-8/h3-4H,1-2H3,(H,10,12)

InChI key: InChIKey=MRYUFIIQECHWMQ-UHFFFAOYSA-N

SMILES: BrC1=CNN=C1C=2C=NN(C2C)C

4-Bromo-1',5'-dimethyl-1H,1'H-3,4'-bipyrazole

CAS: 1006334-21-9

Versatile small molecule scaffold

• Formula: C₈H₉BrN₄
• Purity: Min. 95%
• Molecular weight: 241.09 g/mol

4-bromo-1',5'-dimethyl-1H,1'H-3,4'-bipyrazole

CAS: 1006334-21-9

• Molecular weight: 241.0919952392578