CAS 1006334-23-1: 2-[[4-(1-Methyl-1H-pyrazol-4-yl)-2-pyrimidinyl]thio]acetic acid

Description: 2-[[4-(1-Methyl-1H-pyrazol-4-yl)-2-pyrimidinyl]thio]acetic acid is a chemical compound characterized by its unique structure, which includes a thioether linkage and a carboxylic acid functional group. This compound features a pyrimidine ring substituted with a pyrazole moiety, contributing to its potential biological activity. The presence of the thioether group may enhance its lipophilicity and influence its interaction with biological targets. Typically, compounds of this nature are investigated for their pharmacological properties, including potential roles as enzyme inhibitors or modulators in various biochemical pathways. The molecular structure suggests that it may exhibit specific binding affinities due to the presence of heteroatoms, which can participate in hydrogen bonding and other interactions. Additionally, the compound's solubility and stability in various solvents can be influenced by the functional groups present, making it a candidate for further research in medicinal chemistry and drug development. Overall, 2-[[4-(1-Methyl-1H-pyrazol-4-yl)-2-pyrimidinyl]thio]acetic acid represents a class of compounds with potential therapeutic applications.

Formula: C₁₀H₁₀N₄O₂S

InChI: InChI=1S/C10H10N4O2S/c1-14-5-7(4-12-14)8-2-3-11-10(13-8)17-6-9(15)16/h2-5H,6H2,1H3,(H,15,16)

InChI key: InChIKey=APGSFPPVHNKFAW-UHFFFAOYSA-N

SMILES: O=C(O)CSC=1N=CC=C(N1)C=2C=NN(C2)C

Synonyms:

• Acetic acid, 2-[[4-(1-methyl-1H-pyrazol-4-yl)-2-pyrimidinyl]thio]-
• 2-[[4-(1-Methyl-1H-pyrazol-4-yl)-2-pyrimidinyl]thio]acetic acid

2-{[4-(1-Methyl-1H-pyrazol-4-yl)pyrimidin-2-yl]sulfanyl}acetic acid

CAS: 1006334-23-1

Versatile small molecule scaffold

• Formula: C₁₀H₁₀N₄O₂S
• Purity: Min. 95%
• Molecular weight: 250.28 g/mol

{[4-(1-methyl-1H-pyrazol-4-yl)pyrimidin-2-yl]thio}acetic acid

CAS: 1006334-23-1

• Molecular weight: 250.27999877929688