CAS 1006334-23-1: 2-[[4-(1-Methyl-1H-pyrazol-4-yl)-2-pyrimidinyl]thio]acetic acid
Description:2-[[4-(1-Methyl-1H-pyrazol-4-yl)-2-pyrimidinyl]thio]acetic acid is a chemical compound characterized by its unique structure, which includes a thioether linkage and a carboxylic acid functional group. This compound features a pyrimidine ring substituted with a pyrazole moiety, contributing to its potential biological activity. The presence of the thioether group may enhance its lipophilicity and influence its interaction with biological targets. Typically, compounds of this nature are investigated for their pharmacological properties, including potential roles as enzyme inhibitors or modulators in various biochemical pathways. The molecular structure suggests that it may exhibit specific binding affinities due to the presence of heteroatoms, which can participate in hydrogen bonding and other interactions. Additionally, the compound's solubility and stability in various solvents can be influenced by the functional groups present, making it a candidate for further research in medicinal chemistry and drug development. Overall, 2-[[4-(1-Methyl-1H-pyrazol-4-yl)-2-pyrimidinyl]thio]acetic acid represents a class of compounds with potential therapeutic applications.
Formula:C10H10N4O2S
InChI:InChI=1S/C10H10N4O2S/c1-14-5-7(4-12-14)8-2-3-11-10(13-8)17-6-9(15)16/h2-5H,6H2,1H3,(H,15,16)
InChI key:InChIKey=APGSFPPVHNKFAW-UHFFFAOYSA-N
SMILES:O=C(O)CSC=1N=CC=C(N1)C=2C=NN(C2)C
- Synonyms:
- Acetic acid, 2-[[4-(1-methyl-1H-pyrazol-4-yl)-2-pyrimidinyl]thio]-
- 2-[[4-(1-Methyl-1H-pyrazol-4-yl)-2-pyrimidinyl]thio]acetic acid
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 2-{[4-(1-Methyl-1H-pyrazol-4-yl)pyrimidin-2-yl]sulfanyl}acetic acid REF: 3D-GQB33423CAS: 1006334-23-1 | Min. 95% | To inquire | Thu 08 May 25 |
![]() | {[4-(1-methyl-1H-pyrazol-4-yl)pyrimidin-2-yl]thio}acetic acid REF: 10-F425844CAS: 1006334-23-1 | - - - | - - - | Discontinued product |

2-{[4-(1-Methyl-1H-pyrazol-4-yl)pyrimidin-2-yl]sulfanyl}acetic acid
Ref: 3D-GQB33423
50mg | 469.00 € | ||
500mg | 1,107.00 € |

{[4-(1-methyl-1H-pyrazol-4-yl)pyrimidin-2-yl]thio}acetic acid
Ref: 10-F425844
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
50mg | Discontinued | Request information | |
250mg | Discontinued | Request information |