CAS 1006348-79-3: 4-Bromo-3-(trifluoromethyl)-1H-pyrazole-1-propanoic acid

Description: 4-Bromo-3-(trifluoromethyl)-1H-pyrazole-1-propanoic acid is a chemical compound characterized by its unique structure, which includes a pyrazole ring substituted with a bromine atom and a trifluoromethyl group. This compound typically exhibits properties associated with both acidic and aromatic functionalities, making it of interest in various chemical applications, including pharmaceuticals and agrochemicals. The presence of the trifluoromethyl group enhances its lipophilicity and can influence its biological activity, while the bromine atom may contribute to its reactivity in substitution reactions. The propanoic acid moiety imparts acidic characteristics, allowing for potential interactions in biological systems. Additionally, this compound may exhibit specific solubility characteristics in organic solvents, which can be relevant for its use in synthesis and formulation. Overall, 4-Bromo-3-(trifluoromethyl)-1H-pyrazole-1-propanoic acid is a versatile compound with potential applications in medicinal chemistry and material science, warranting further investigation into its properties and reactivity.

Formula: C₇H₆BrF₃N₂O₂

InChI: InChI=1S/C7H6BrF3N2O2/c8-4-3-13(2-1-5(14)15)12-6(4)7(9,10)11/h3H,1-2H2,(H,14,15)

InChI key: InChIKey=AORMTPZTDCLQLT-UHFFFAOYSA-N

SMILES: O=C(O)CCN1N=C(C(Br)=C1)C(F)(F)F

Synonyms:

• 4-Bromo-3-(trifluoromethyl)-1H-pyrazole-1-propanoic acid
• 1H-Pyrazole-1-propanoic acid, 4-bromo-3-(trifluoromethyl)-

3-[4-Bromo-3-(trifluoromethyl)-1H-pyrazol-1-yl]propanoic acid

CAS: 1006348-79-3

• Molecular weight: 287.03g/mol

3-[4-Bromo-3-(trifluoromethyl)-1H-pyrazol-1-yl]propanoic acid

CAS: 1006348-79-3

Versatile small molecule scaffold

• Formula: C₇H₆BrF₃N₂O₂
• Purity: Min. 95%
• Molecular weight: 287.03 g/mol

3-[4-bromo-3-(trifluoromethyl)-1H-pyrazol-1-yl]propanoic acid

CAS: 1006348-79-3

• Molecular weight: 287.0360107421875