CAS 100910-69-8: Pyrimidine, 4-amino-2-propyl- (6CI)

Description: Pyrimidine, 4-amino-2-propyl- (6CI), with the CAS number 100910-69-8, is a heterocyclic organic compound characterized by a pyrimidine ring substituted with an amino group and a propyl group. Pyrimidines are six-membered aromatic rings containing two nitrogen atoms at positions 1 and 3. The presence of the amino group at the 4-position and the propyl group at the 2-position contributes to its unique chemical properties, including potential basicity and reactivity. This compound may exhibit polar characteristics due to the amino group, influencing its solubility in various solvents. It can participate in hydrogen bonding, which may affect its interactions in biological systems or chemical reactions. Pyrimidine derivatives are often of interest in medicinal chemistry due to their role in nucleic acid structure and function, as well as their potential as pharmaceuticals. The specific properties, such as melting point, boiling point, and reactivity, would depend on the molecular structure and substituents, making it relevant for various applications in organic synthesis and drug development.

Formula: C₇H₁₁N₃

InChI: InChI=1S/C7H11N3/c1-2-3-7-9-5-4-6(8)10-7/h4-5H,2-3H2,1H3,(H2,8,9,10)

InChI key: InChIKey=BTMCCOMLYMKBFL-UHFFFAOYSA-N

SMILES: N=1C=CC(=NC1CCC)N

4-Pyrimidinamine, 2-propyl-

CAS: 100910-69-8

• Formula: C₇H₁₁N₃
• Molecular weight: 137.1823

2-Propylpyrimidin-4-amine

CAS: 100910-69-8

Versatile small molecule scaffold

• Formula: C₇H₁₁N₃
• Purity: Min. 95%
• Molecular weight: 137.19 g/mol

2-Propylpyrimidin-4-amine

CAS: 100910-69-8

• Purity: 97%
• Molecular weight: 137.18600463867188